C13H26O4 — CID 142877166
ethane;propane;2,2,5,5-tetramethyl-1,3-dioxane-4,6-dione (PubChem CID 142877166) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is ethane;propane;2,2,5,5-tetramethyl-1,3-dioxane-4,6-dione.
| Compound Name | ethane;propane;2,2,5,5-tetramethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 142877166 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | ethane;propane;2,2,5,5-tetramethyl-1,3-dioxane-4,6-dione |
| SMILES | CC.CC1(C)OC(=O)C(C)(C)C(=O)O1.CCC |
| InChI | InChI=1S/C8H12O4.C3H8.C2H6/c1-7(2)5(9)11-8(3,4)12-6(7)10;1-3-2;1-2/h1-4H3;3H2,1-2H3;1-2H3 |
| InChIKey | MSTKBNXZLSUUNU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|