C12H16O8 — CID 175887369
5,5,11,11-tetramethyl-1,3,7,9-tetraoxacyclododecane-4,6,10,12-tetrone (PubChem CID 175887369) has the molecular formula C12H16O8 and a molecular weight of 288.25 g/mol. Its IUPAC name is 5,5,11,11-tetramethyl-1,3,7,9-tetraoxacyclododecane-4,6,10,12-tetrone.
| Compound Name | 5,5,11,11-tetramethyl-1,3,7,9-tetraoxacyclododecane-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 175887369 |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 5,5,11,11-tetramethyl-1,3,7,9-tetraoxacyclododecane-4,6,10,12-tetrone |
| SMILES | CC1(C)C(=O)OCOC(=O)C(C)(C)C(=O)OCOC1=O |
| InChI | InChI=1S/C12H16O8/c1-11(2)7(13)17-5-19-9(15)12(3,4)10(16)20-6-18-8(11)14/h5-6H2,1-4H3 |
| InChIKey | JFCCMWTUWAIMMR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.25 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|