C14H16O4 — CID 118947181
5-methyl-5-(3-phenylpropyl)-1,3-dioxane-4,6-dione (PubChem CID 118947181) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 5-methyl-5-(3-phenylpropyl)-1,3-dioxane-4,6-dione.
| Compound Name | 5-methyl-5-(3-phenylpropyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 118947181 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 5-methyl-5-(3-phenylpropyl)-1,3-dioxane-4,6-dione |
| SMILES | CC1(CCCc2ccccc2)C(=O)OCOC1=O |
| InChI | InChI=1S/C14H16O4/c1-14(12(15)17-10-18-13(14)16)9-5-8-11-6-3-2-4-7-11/h2-4,6-7H,5,8-10H2,1H3 |
| InChIKey | HOMGOCLUPOHESA-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|