C38H50O2 — CID 124527996
(1S,3S,4S)-1,7,7-trimethyl-3-(3-phenylpropyl)-3-[(1S,2R,4R)-4,7,7-trimethyl-3-oxo-2-(3-phenylpropyl)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-one (PubChem CID 124527996) has the molecular formula C38H50O2 and a molecular weight of 538.82 g/mol. Its IUPAC name is (1S,3S,4S)-1,7,7-trimethyl-3-(3-phenylpropyl)-3-[(1S,2R,4R)-4,7,7-trimethyl-3-oxo-2-(3-phenylpropyl)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3S,4S)-1,7,7-trimethyl-3-(3-phenylpropyl)-3-[(1S,2R,4R)-4,7,7-trimethyl-3-oxo-2-(3-phenylpropyl)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 124527996 |
| Molecular Formula | C38H50O2 |
| Molecular Weight | 538.82 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | (1S,3S,4S)-1,7,7-trimethyl-3-(3-phenylpropyl)-3-[(1S,2R,4R)-4,7,7-trimethyl-3-oxo-2-(3-phenylpropyl)-2-bicyclo[2.2.1]heptanyl]bicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C(=O)[C@@]2(CCCc1ccccc1)[C@@]1(CCCc2ccccc2)C(=O)[C@@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C38H50O2/c1-33(2)29-21-25-35(33,5)31(39)37(29,23-13-19-27-15-9-7-10-16-27)38(24-14-20-28-17-11-8-12-18-28)30-22-26-36(6,32(38)40)34(30,3)4/h7-12,15-18,29-30H,13-14,19-26H2,1-6H3/t29-,30-,35-,36+,37-,38+/m0/s1 |
| InChIKey | KAWVUHXMUIOISQ-GYERKDMRSA-N |
| XLogP | 9.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.82 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |