C12H16O5 — CID 66610288
4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2,2-dicarboxylic acid (PubChem CID 66610288) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2,2-dicarboxylic acid.
| Compound Name | 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 66610288 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2,2-dicarboxylic acid |
| SMILES | CC12CCC(C(C(=O)O)(C(=O)O)C1=O)C2(C)C |
| InChI | InChI=1S/C12H16O5/c1-10(2)6-4-5-11(10,3)7(13)12(6,8(14)15)9(16)17/h6H,4-5H2,1-3H3,(H,14,15)(H,16,17) |
| InChIKey | IZAYLYRBFFITOQ-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|