C12H16O8S — CID 175883045
7,7-dimethyl-3-oxo-4-(sulfomethyl)bicyclo[2.2.1]heptane-2,2-dicarboxylic acid (PubChem CID 175883045) has the molecular formula C12H16O8S and a molecular weight of 320.32 g/mol. Its IUPAC name is 7,7-dimethyl-3-oxo-4-(sulfomethyl)bicyclo[2.2.1]heptane-2,2-dicarboxylic acid.
| Compound Name | 7,7-dimethyl-3-oxo-4-(sulfomethyl)bicyclo[2.2.1]heptane-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 175883045 |
| Molecular Formula | C12H16O8S |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 7,7-dimethyl-3-oxo-4-(sulfomethyl)bicyclo[2.2.1]heptane-2,2-dicarboxylic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2(C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H16O8S/c1-10(2)6-3-4-11(10,5-21(18,19)20)7(13)12(6,8(14)15)9(16)17/h6H,3-5H2,1-2H3,(H,14,15)(H,16,17)(H,18,19,20) |
| InChIKey | MDHHGBPADXCGFB-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|