C17H20NaO4S — CID 159430806
CID 159430806 (PubChem CID 159430806) has the molecular formula C17H20NaO4S and a molecular weight of 343.40 g/mol.
| Compound Name | CID 159430806 |
|---|---|
| PubChem CID | 159430806 |
| Molecular Formula | C17H20NaO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2=Cc1ccccc1.[Na] |
| InChI | InChI=1S/C17H20O4S.Na/c1-16(2)14-8-9-17(16,11-22(19,20)21)15(18)13(14)10-12-6-4-3-5-7-12;/h3-7,10,14H,8-9,11H2,1-2H3,(H,19,20,21); |
| InChIKey | LQYPRVPKKZSNBV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|