C19H24O — CID 118477603
(3E)-1-ethyl-7,7-dimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one (PubChem CID 118477603) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is (3E)-1-ethyl-7,7-dimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one.
| Compound Name | (3E)-1-ethyl-7,7-dimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 118477603 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (3E)-1-ethyl-7,7-dimethyl-3-[(4-methylphenyl)methylidene]bicyclo[2.2.1]heptan-2-one |
| SMILES | CCC12CCC(/C(=C\c3ccc(C)cc3)C1=O)C2(C)C |
| InChI | InChI=1S/C19H24O/c1-5-19-11-10-16(18(19,3)4)15(17(19)20)12-14-8-6-13(2)7-9-14/h6-9,12,16H,5,10-11H2,1-4H3/b15-12+ |
| InChIKey | BGPXJQWOFKNWTO-NTCAYCPXSA-N |
| XLogP | 4.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|