C12H17N3O3 — CID 10911978
methyl (1S,4R)-2-azido-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 10911978) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is methyl (1S,4R)-2-azido-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,4R)-2-azido-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 10911978 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | methyl (1S,4R)-2-azido-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)C1(N=[N+]=[N-])C(=O)[C@]2(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C12H17N3O3/c1-10(2)7-5-6-11(10,3)8(16)12(7,14-15-13)9(17)18-4/h7H,5-6H2,1-4H3/t7-,11-,12?/m0/s1 |
| InChIKey | VELWBVGXPONUTH-KBCWANFGSA-N |
| XLogP | 2.23 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|