C11H16Br2O — CID 23309185
(1R,3S,4R)-3-bromo-3-(bromomethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 23309185) has the molecular formula C11H16Br2O and a molecular weight of 324.06 g/mol. Its IUPAC name is (1R,3S,4R)-3-bromo-3-(bromomethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3S,4R)-3-bromo-3-(bromomethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 23309185 |
| Molecular Formula | C11H16Br2O |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | (1R,3S,4R)-3-bromo-3-(bromomethyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)C(=O)[C@]2(Br)CBr |
| InChI | InChI=1S/C11H16Br2O/c1-9(2)7-4-5-10(9,3)8(14)11(7,13)6-12/h7H,4-6H2,1-3H3/t7-,10+,11+/m1/s1 |
| InChIKey | WQNULSXJEQQGSF-GGVZMXCHSA-N |
| XLogP | 3.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|