C10H13BrO2 — CID 5198403
1-(bromomethyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 5198403) has the molecular formula C10H13BrO2 and a molecular weight of 245.12 g/mol. Its IUPAC name is 1-(bromomethyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 1-(bromomethyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 5198403 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 1-(bromomethyl)-7,7-dimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC1(C)C2CCC1(CBr)C(=O)C2=O |
| InChI | InChI=1S/C10H13BrO2/c1-9(2)6-3-4-10(9,5-11)8(13)7(6)12/h6H,3-5H2,1-2H3 |
| InChIKey | XJXZFLDQSFSDQK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|