C10H13Br3O — CID 98135386
(1R,3R,4S,7R)-3-bromo-1,7-bis(bromomethyl)-7-methylbicyclo[2.2.1]heptan-2-one (PubChem CID 98135386) has the molecular formula C10H13Br3O and a molecular weight of 388.93 g/mol. Its IUPAC name is (1R,3R,4S,7R)-3-bromo-1,7-bis(bromomethyl)-7-methylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R,3R,4S,7R)-3-bromo-1,7-bis(bromomethyl)-7-methylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 98135386 |
| Molecular Formula | C10H13Br3O |
| Molecular Weight | 388.93 g/mol |
| Exact Mass | 385.85 |
| IUPAC Name | (1R,3R,4S,7R)-3-bromo-1,7-bis(bromomethyl)-7-methylbicyclo[2.2.1]heptan-2-one |
| SMILES | C[C@@]1(CBr)[C@@H]2CC[C@]1(CBr)C(=O)[C@@H]2Br |
| InChI | InChI=1S/C10H13Br3O/c1-9(4-11)6-2-3-10(9,5-12)8(14)7(6)13/h6-7H,2-5H2,1H3/t6-,7-,9-,10+/m1/s1 |
| InChIKey | FYVXSJHUBPYLLD-ZXZZCXTASA-N |
| XLogP | 3.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.93 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|