C10H14BrO4S- — CID 7017192
[(1S,3S,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate (PubChem CID 7017192) has the molecular formula C10H14BrO4S- and a molecular weight of 310.19 g/mol. Its IUPAC name is [(1S,3S,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate.
| Compound Name | [(1S,3S,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
|---|---|
| PubChem CID | 7017192 |
| Molecular Formula | C10H14BrO4S- |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | [(1S,3S,4S)-3-bromo-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonate |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(CS(=O)(=O)[O-])C(=O)[C@H]2Br |
| InChI | InChI=1S/C10H15BrO4S/c1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11/h6-7H,3-5H2,1-2H3,(H,13,14,15)/p-1/t6-,7+,10-/m1/s1 |
| InChIKey | XUJHKPSBHDQIOD-MATHAZKKSA-M |
| XLogP | 1.30 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|