C10H14BrFO4S — CID 170691244
[3-bromo-7-(fluoromethyl)-7-methyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 170691244) has the molecular formula C10H14BrFO4S and a molecular weight of 329.19 g/mol. Its IUPAC name is [3-bromo-7-(fluoromethyl)-7-methyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [3-bromo-7-(fluoromethyl)-7-methyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 170691244 |
| Molecular Formula | C10H14BrFO4S |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | [3-bromo-7-(fluoromethyl)-7-methyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(CF)C2CCC1(CS(=O)(=O)O)C(=O)C2Br |
| InChI | InChI=1S/C10H14BrFO4S/c1-9(4-12)6-2-3-10(9,5-17(14,15)16)8(13)7(6)11/h6-7H,2-5H2,1H3,(H,14,15,16) |
| InChIKey | OODHBHJMQQAWIX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|