C14H24BrNO3S — CID 7039648
1-[(1R,3R,4S,7S)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]-N,N-diethylmethanesulfonamide (PubChem CID 7039648) has the molecular formula C14H24BrNO3S and a molecular weight of 366.32 g/mol. Its IUPAC name is 1-[(1R,3R,4S,7S)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]-N,N-diethylmethanesulfonamide.
| Compound Name | 1-[(1R,3R,4S,7S)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]-N,N-diethylmethanesulfonamide |
|---|---|
| PubChem CID | 7039648 |
| Molecular Formula | C14H24BrNO3S |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 1-[(1R,3R,4S,7S)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]-N,N-diethylmethanesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)C[C@@]1(C)[C@@H]2CC[C@@]1(C)C(=O)[C@@H]2Br |
| InChI | InChI=1S/C14H24BrNO3S/c1-5-16(6-2)20(18,19)9-14(4)10-7-8-13(14,3)12(17)11(10)15/h10-11H,5-9H2,1-4H3/t10-,11-,13+,14+/m1/s1 |
| InChIKey | GABZYPCVFFKYPB-RFHZTLPTSA-N |
| XLogP | 2.43 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|