C13H22BrNO3S — CID 3267122
1-(3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl)-N-propan-2-ylmethanesulfonamide (PubChem CID 3267122) has the molecular formula C13H22BrNO3S and a molecular weight of 352.29 g/mol. Its IUPAC name is 1-(3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl)-N-propan-2-ylmethanesulfonamide.
| Compound Name | 1-(3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl)-N-propan-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 3267122 |
| Molecular Formula | C13H22BrNO3S |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-(3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl)-N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)NS(=O)(=O)CC1(C)C2CCC1(C)C(=O)C2Br |
| InChI | InChI=1S/C13H22BrNO3S/c1-8(2)15-19(17,18)7-13(4)9-5-6-12(13,3)11(16)10(9)14/h8-10,15H,5-7H2,1-4H3 |
| InChIKey | LHRRJWWOLCXNLP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|