C10H15BrO4S — CID 155888025
[(1R,7R)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 155888025) has the molecular formula C10H15BrO4S and a molecular weight of 311.20 g/mol. Its IUPAC name is [(1R,7R)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [(1R,7R)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 155888025 |
| Molecular Formula | C10H15BrO4S |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | [(1R,7R)-3-bromo-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | C[C@]12CCC(C(Br)C1=O)[C@@]2(C)CS(=O)(=O)O |
| InChI | InChI=1S/C10H15BrO4S/c1-9-4-3-6(7(11)8(9)12)10(9,2)5-16(13,14)15/h6-7H,3-5H2,1-2H3,(H,13,14,15)/t6?,7?,9-,10+/m0/s1 |
| InChIKey | MFEDKMBNKNOUPA-CPTYRYLOSA-N |
| XLogP | 1.64 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|