C10H13Br2NO3 — CID 124893986
(1S,3S,4R,7S)-3-bromo-7-(bromomethyl)-1,7-dimethyl-3-nitrobicyclo[2.2.1]heptan-2-one (PubChem CID 124893986) has the molecular formula C10H13Br2NO3 and a molecular weight of 355.03 g/mol. Its IUPAC name is (1S,3S,4R,7S)-3-bromo-7-(bromomethyl)-1,7-dimethyl-3-nitrobicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3S,4R,7S)-3-bromo-7-(bromomethyl)-1,7-dimethyl-3-nitrobicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 124893986 |
| Molecular Formula | C10H13Br2NO3 |
| Molecular Weight | 355.03 g/mol |
| Exact Mass | 352.93 |
| IUPAC Name | (1S,3S,4R,7S)-3-bromo-7-(bromomethyl)-1,7-dimethyl-3-nitrobicyclo[2.2.1]heptan-2-one |
| SMILES | C[C@]1(CBr)[C@H]2CC[C@]1(C)C(=O)[C@]2(Br)[N+](=O)[O-] |
| InChI | InChI=1S/C10H13Br2NO3/c1-8-4-3-6(9(8,2)5-11)10(12,7(8)14)13(15)16/h6H,3-5H2,1-2H3/t6-,8-,9+,10-/m1/s1 |
| InChIKey | QNOPRINAANCQME-SFKDOBOXSA-N |
| XLogP | 2.75 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.03 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|