C11H18BrN4O+ — CID 7126179
[(E)-[(1S,4R,7R)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]amino]-(diaminomethylidene)azanium (PubChem CID 7126179) has the molecular formula C11H18BrN4O+ and a molecular weight of 302.20 g/mol. Its IUPAC name is [(E)-[(1S,4R,7R)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]amino]-(diaminomethylidene)azanium.
| Compound Name | [(E)-[(1S,4R,7R)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]amino]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 7126179 |
| Molecular Formula | C11H18BrN4O+ |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | [(E)-[(1S,4R,7R)-7-(bromomethyl)-4,7-dimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene]amino]-(diaminomethylidene)azanium |
| SMILES | C[C@]12CC[C@H](/C(=N\[NH+]=C(N)N)C1=O)[C@@]2(C)CBr |
| InChI | InChI=1S/C11H17BrN4O/c1-10-4-3-6(11(10,2)5-12)7(8(10)17)15-16-9(13)14/h6H,3-5H2,1-2H3,(H4,13,14,16)/p+1/b15-7+/t6-,10+,11-/m1/s1 |
| InChIKey | MWWIFFOPFPFRNH-BNUZLQKQSA-O |
| XLogP | -0.90 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|