C12H16O4 — CID 129374717
3-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]propanoic acid (PubChem CID 129374717) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 3-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]propanoic acid.
| Compound Name | 3-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]propanoic acid |
|---|---|
| PubChem CID | 129374717 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 3-[(1R,4S,7R)-1,7-dimethyl-2,3-dioxo-7-bicyclo[2.2.1]heptanyl]propanoic acid |
| SMILES | C[C@]12CC[C@H](C(=O)C1=O)[C@@]2(C)CCC(=O)O |
| InChI | InChI=1S/C12H16O4/c1-11(6-4-8(13)14)7-3-5-12(11,2)10(16)9(7)15/h7H,3-6H2,1-2H3,(H,13,14)/t7-,11-,12+/m1/s1 |
| InChIKey | HGJUJPUCZZMEQY-HFKOZYHYSA-N |
| XLogP | 1.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|