C17H26O4 — CID 162219278
7,7-dimethyl-2,3-dioxabicyclo[2.2.1]heptane;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione (PubChem CID 162219278) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 7,7-dimethyl-2,3-dioxabicyclo[2.2.1]heptane;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione.
| Compound Name | 7,7-dimethyl-2,3-dioxabicyclo[2.2.1]heptane;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
|---|---|
| PubChem CID | 162219278 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 7,7-dimethyl-2,3-dioxabicyclo[2.2.1]heptane;1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-dione |
| SMILES | CC1(C)C2CCC1OO2.CC12CCC(C(=O)C1=O)C2(C)C |
| InChI | InChI=1S/C10H14O2.C7H12O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11;1-7(2)5-3-4-6(7)9-8-5/h6H,4-5H2,1-3H3;5-6H,3-4H2,1-2H3 |
| InChIKey | ZTXBDSXWPCEHRE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|