C11H14Br2O2 — CID 7054424
(1S,5R)-3,3-dibromo-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione (PubChem CID 7054424) has the molecular formula C11H14Br2O2 and a molecular weight of 338.04 g/mol. Its IUPAC name is (1S,5R)-3,3-dibromo-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione.
| Compound Name | (1S,5R)-3,3-dibromo-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 7054424 |
| Molecular Formula | C11H14Br2O2 |
| Molecular Weight | 338.04 g/mol |
| Exact Mass | 335.94 |
| IUPAC Name | (1S,5R)-3,3-dibromo-1,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=O)C(Br)(Br)C2=O |
| InChI | InChI=1S/C11H14Br2O2/c1-9(2)6-4-5-10(9,3)8(15)11(12,13)7(6)14/h6H,4-5H2,1-3H3/t6-,10+/m0/s1 |
| InChIKey | HAJCJFAJMJVDRA-QUBYGPBYSA-N |
| XLogP | 3.07 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.04 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|