C12H20OS — CID 12859502
1,3,3,7,7-pentamethyl-2-sulfinylbicyclo[2.2.1]heptane (PubChem CID 12859502) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 1,3,3,7,7-pentamethyl-2-sulfinylbicyclo[2.2.1]heptane.
| Compound Name | 1,3,3,7,7-pentamethyl-2-sulfinylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 12859502 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1,3,3,7,7-pentamethyl-2-sulfinylbicyclo[2.2.1]heptane |
| SMILES | CC1(C)C(=S=O)C2(C)CCC1C2(C)C |
| InChI | InChI=1S/C12H20OS/c1-10(2)8-6-7-12(5,9(10)14-13)11(8,3)4/h8H,6-7H2,1-5H3 |
| InChIKey | GYBHAWIAPIFFNJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|