C23H24OS — CID 135004145
1,7,7-trimethyl-2',2'-diphenylspiro[bicyclo[2.2.1]heptane-3,3'-thiirane]-2-one (PubChem CID 135004145) has the molecular formula C23H24OS and a molecular weight of 348.51 g/mol. Its IUPAC name is 1,7,7-trimethyl-2',2'-diphenylspiro[bicyclo[2.2.1]heptane-3,3'-thiirane]-2-one.
| Compound Name | 1,7,7-trimethyl-2',2'-diphenylspiro[bicyclo[2.2.1]heptane-3,3'-thiirane]-2-one |
|---|---|
| PubChem CID | 135004145 |
| Molecular Formula | C23H24OS |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 1,7,7-trimethyl-2',2'-diphenylspiro[bicyclo[2.2.1]heptane-3,3'-thiirane]-2-one |
| SMILES | CC12CCC(C1(C)C)C1(SC1(c1ccccc1)c1ccccc1)C2=O |
| InChI | InChI=1S/C23H24OS/c1-20(2)18-14-15-21(20,3)19(24)23(18)22(25-23,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18H,14-15H2,1-3H3 |
| InChIKey | XDXSWEJHGFYIPY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|