C16H19Cl2NO2S — CID 134935939
(NZ)-N-[(1R,4S)-3,3-dichloro-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzenesulfonamide (PubChem CID 134935939) has the molecular formula C16H19Cl2NO2S and a molecular weight of 360.31 g/mol. Its IUPAC name is (NZ)-N-[(1R,4S)-3,3-dichloro-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[(1R,4S)-3,3-dichloro-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 134935939 |
| Molecular Formula | C16H19Cl2NO2S |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (NZ)-N-[(1R,4S)-3,3-dichloro-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]benzenesulfonamide |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)/C(=N/S(=O)(=O)c1ccccc1)C2(Cl)Cl |
| InChI | InChI=1S/C16H19Cl2NO2S/c1-14(2)12-9-10-15(14,3)13(16(12,17)18)19-22(20,21)11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3/b19-13-/t12-,15-/m0/s1 |
| InChIKey | KRIBWXQZUGCEEO-GNYGEORDSA-N |
| XLogP | 4.45 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|