C16H17Cl2NO3S — CID 7721704
N-[(5R,6S)-5,6-dichloro-5-methyl-4-oxo-2-propan-2-ylcyclohex-2-en-1-ylidene]benzenesulfonamide (PubChem CID 7721704) has the molecular formula C16H17Cl2NO3S and a molecular weight of 374.29 g/mol. Its IUPAC name is N-[(5R,6S)-5,6-dichloro-5-methyl-4-oxo-2-propan-2-ylcyclohex-2-en-1-ylidene]benzenesulfonamide.
| Compound Name | N-[(5R,6S)-5,6-dichloro-5-methyl-4-oxo-2-propan-2-ylcyclohex-2-en-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 7721704 |
| Molecular Formula | C16H17Cl2NO3S |
| Molecular Weight | 374.29 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | N-[(5R,6S)-5,6-dichloro-5-methyl-4-oxo-2-propan-2-ylcyclohex-2-en-1-ylidene]benzenesulfonamide |
| SMILES | CC(C)C1=CC(=O)[C@@](C)(Cl)[C@@H](Cl)C1=NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17Cl2NO3S/c1-10(2)12-9-13(20)16(3,18)15(17)14(12)19-23(21,22)11-7-5-4-6-8-11/h4-10,15H,1-3H3/t15-,16+/m0/s1 |
| InChIKey | DWZUIUHHYJXENG-JKSUJKDBSA-N |
| XLogP | 3.59 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|