C16H16Cl3NO3S — CID 4191919
N-(2,3,5-trichloro-3-methyl-4-oxo-6-propan-2-ylcyclohexa-1,5-dien-1-yl)benzenesulfonamide (PubChem CID 4191919) has the molecular formula C16H16Cl3NO3S and a molecular weight of 408.73 g/mol. Its IUPAC name is N-(2,3,5-trichloro-3-methyl-4-oxo-6-propan-2-ylcyclohexa-1,5-dien-1-yl)benzenesulfonamide.
| Compound Name | N-(2,3,5-trichloro-3-methyl-4-oxo-6-propan-2-ylcyclohexa-1,5-dien-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 4191919 |
| Molecular Formula | C16H16Cl3NO3S |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | N-(2,3,5-trichloro-3-methyl-4-oxo-6-propan-2-ylcyclohexa-1,5-dien-1-yl)benzenesulfonamide |
| SMILES | CC(C)C1=C(Cl)C(=O)C(C)(Cl)C(Cl)=C1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H16Cl3NO3S/c1-9(2)11-12(17)15(21)16(3,19)14(18)13(11)20-24(22,23)10-7-5-4-6-8-10/h4-9,20H,1-3H3 |
| InChIKey | DKFVRBFOCMNGIZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|