C26H22Cl2N2O6S2 — CID 58761533
N-[3-[1-[5-(benzenesulfonamido)-3-chloro-2-hydroxyphenyl]ethyl]-5-chloro-4-hydroxyphenyl]benzenesulfonamide (PubChem CID 58761533) has the molecular formula C26H22Cl2N2O6S2 and a molecular weight of 593.51 g/mol. Its IUPAC name is N-[3-[1-[5-(benzenesulfonamido)-3-chloro-2-hydroxyphenyl]ethyl]-5-chloro-4-hydroxyphenyl]benzenesulfonamide.
| Compound Name | N-[3-[1-[5-(benzenesulfonamido)-3-chloro-2-hydroxyphenyl]ethyl]-5-chloro-4-hydroxyphenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 58761533 |
| Molecular Formula | C26H22Cl2N2O6S2 |
| Molecular Weight | 593.51 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | N-[3-[1-[5-(benzenesulfonamido)-3-chloro-2-hydroxyphenyl]ethyl]-5-chloro-4-hydroxyphenyl]benzenesulfonamide |
| SMILES | CC(c1cc(NS(=O)(=O)c2ccccc2)cc(Cl)c1O)c1cc(NS(=O)(=O)c2ccccc2)cc(Cl)c1O |
| InChI | InChI=1S/C26H22Cl2N2O6S2/c1-16(21-12-17(14-23(27)25(21)31)29-37(33,34)19-8-4-2-5-9-19)22-13-18(15-24(28)26(22)32)30-38(35,36)20-10-6-3-7-11-20/h2-16,29-32H,1H3 |
| InChIKey | VOZJAPFVYIEDRN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.51 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|