C22H23NO6S2 — CID 3580331
N-[3-(benzenesulfonyl)-4-hydroxy-5-propan-2-ylphenyl]-4-methoxybenzenesulfonamide (PubChem CID 3580331) has the molecular formula C22H23NO6S2 and a molecular weight of 461.56 g/mol. Its IUPAC name is N-[3-(benzenesulfonyl)-4-hydroxy-5-propan-2-ylphenyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[3-(benzenesulfonyl)-4-hydroxy-5-propan-2-ylphenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 3580331 |
| Molecular Formula | C22H23NO6S2 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[3-(benzenesulfonyl)-4-hydroxy-5-propan-2-ylphenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(C(C)C)c(O)c(S(=O)(=O)c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C22H23NO6S2/c1-15(2)20-13-16(23-31(27,28)19-11-9-17(29-3)10-12-19)14-21(22(20)24)30(25,26)18-7-5-4-6-8-18/h4-15,23-24H,1-3H3 |
| InChIKey | RZPAJFKSRQKNPR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|