C21H20ClNO6S2 — CID 1259998
N-[5-(4-chlorophenyl)sulfonyl-4-hydroxy-2,3-dimethylphenyl]-4-methoxybenzenesulfonamide (PubChem CID 1259998) has the molecular formula C21H20ClNO6S2 and a molecular weight of 481.98 g/mol. Its IUPAC name is N-[5-(4-chlorophenyl)sulfonyl-4-hydroxy-2,3-dimethylphenyl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[5-(4-chlorophenyl)sulfonyl-4-hydroxy-2,3-dimethylphenyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 1259998 |
| Molecular Formula | C21H20ClNO6S2 |
| Molecular Weight | 481.98 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | N-[5-(4-chlorophenyl)sulfonyl-4-hydroxy-2,3-dimethylphenyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(S(=O)(=O)c3ccc(Cl)cc3)c(O)c(C)c2C)cc1 |
| InChI | InChI=1S/C21H20ClNO6S2/c1-13-14(2)21(24)20(30(25,26)17-8-4-15(22)5-9-17)12-19(13)23-31(27,28)18-10-6-16(29-3)7-11-18/h4-12,23-24H,1-3H3 |
| InChIKey | OGTMFJAOODDSCQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.98 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|