C14H11Cl3N2O5S — CID 6063235
(NZ)-3-nitro-N-(3,5,6-trichloro-2,5-dimethyl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide (PubChem CID 6063235) has the molecular formula C14H11Cl3N2O5S and a molecular weight of 425.68 g/mol. Its IUPAC name is (NZ)-3-nitro-N-(3,5,6-trichloro-2,5-dimethyl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide.
| Compound Name | (NZ)-3-nitro-N-(3,5,6-trichloro-2,5-dimethyl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 6063235 |
| Molecular Formula | C14H11Cl3N2O5S |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | (NZ)-3-nitro-N-(3,5,6-trichloro-2,5-dimethyl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide |
| SMILES | CC1=C(Cl)C(=O)C(C)(Cl)C(Cl)/C1=N\S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H11Cl3N2O5S/c1-7-10(15)13(20)14(2,17)12(16)11(7)18-25(23,24)9-5-3-4-8(6-9)19(21)22/h3-6,12H,1-2H3/b18-11- |
| InChIKey | RIYBORUNOYPDBQ-WQRHYEAKSA-N |
| XLogP | 3.42 |
| TPSA | 106.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|