C9H10ClN3O4S — CID 12815764
N,N-dimethyl-N'-(3-nitrophenyl)sulfonylcarbamimidoyl chloride (PubChem CID 12815764) has the molecular formula C9H10ClN3O4S and a molecular weight of 291.72 g/mol. Its IUPAC name is N,N-dimethyl-N'-(3-nitrophenyl)sulfonylcarbamimidoyl chloride.
| Compound Name | N,N-dimethyl-N'-(3-nitrophenyl)sulfonylcarbamimidoyl chloride |
|---|---|
| PubChem CID | 12815764 |
| Molecular Formula | C9H10ClN3O4S |
| Molecular Weight | 291.72 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | N,N-dimethyl-N'-(3-nitrophenyl)sulfonylcarbamimidoyl chloride |
| SMILES | CN(C)/C(Cl)=N/S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10ClN3O4S/c1-12(2)9(10)11-18(16,17)8-5-3-4-7(6-8)13(14)15/h3-6H,1-2H3/b11-9+ |
| InChIKey | WWLIGXINORJTAD-PKNBQFBNSA-N |
| XLogP | 1.44 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.72 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|