C16H16Cl2N2O6S — CID 6527353
[(Z)-(5,6-dichloro-6-methyl-4-oxo-3-propan-2-ylcyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate (PubChem CID 6527353) has the molecular formula C16H16Cl2N2O6S and a molecular weight of 435.29 g/mol. Its IUPAC name is [(Z)-(5,6-dichloro-6-methyl-4-oxo-3-propan-2-ylcyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate.
| Compound Name | [(Z)-(5,6-dichloro-6-methyl-4-oxo-3-propan-2-ylcyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 6527353 |
| Molecular Formula | C16H16Cl2N2O6S |
| Molecular Weight | 435.29 g/mol |
| Exact Mass | 434.01 |
| IUPAC Name | [(Z)-(5,6-dichloro-6-methyl-4-oxo-3-propan-2-ylcyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate |
| SMILES | CC(C)C1=C/C(=N/OS(=O)(=O)c2cccc([N+](=O)[O-])c2)C(C)(Cl)C(Cl)C1=O |
| InChI | InChI=1S/C16H16Cl2N2O6S/c1-9(2)12-8-13(16(3,18)15(17)14(12)21)19-26-27(24,25)11-6-4-5-10(7-11)20(22)23/h4-9,15H,1-3H3/b19-13- |
| InChIKey | BEWOMJHQXJHAFL-UYRXBGFRSA-N |
| XLogP | 3.43 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.29 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|