C22H35F2N3O8S — CID 159825017
(3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-ol;[(3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-yl] 3-nitrobenzenesulfonate (PubChem CID 159825017) has the molecular formula C22H35F2N3O8S and a molecular weight of 539.60 g/mol. Its IUPAC name is (3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-ol;[(3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-yl] 3-nitrobenzenesulfonate.
| Compound Name | (3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-ol;[(3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-yl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 159825017 |
| Molecular Formula | C22H35F2N3O8S |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-ol;[(3R,4R,5S)-5-fluoro-6-methoxyimino-4-methylhexan-3-yl] 3-nitrobenzenesulfonate |
| SMILES | CC[C@@H](O)[C@@H](C)[C@H](F)C=NOC.CC[C@@H](OS(=O)(=O)c1cccc([N+](=O)[O-])c1)[C@@H](C)[C@H](F)C=NOC |
| InChI | InChI=1S/C14H19FN2O6S.C8H16FNO2/c1-4-14(10(2)13(15)9-16-22-3)23-24(20,21)12-7-5-6-11(8-12)17(18)19;1-4-8(11)6(2)7(9)5-10-12-3/h5-10,13-14H,4H2,1-3H3;5-8,11H,4H2,1-3H3/t10-,13+,14+;6-,7+,8+/m00/s1 |
| InChIKey | NMSLFMGPHWWBNT-JJXWNICWSA-N |
| XLogP | 4.05 |
| TPSA | 149.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|