C14H12Cl2N2O6S — CID 6124500
[(Z)-(5,6-dichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate (PubChem CID 6124500) has the molecular formula C14H12Cl2N2O6S and a molecular weight of 407.23 g/mol. Its IUPAC name is [(Z)-(5,6-dichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate.
| Compound Name | [(Z)-(5,6-dichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 6124500 |
| Molecular Formula | C14H12Cl2N2O6S |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | [(Z)-(5,6-dichloro-2,3-dimethyl-4-oxocyclohex-2-en-1-ylidene)amino] 3-nitrobenzenesulfonate |
| SMILES | CC1=C(C)/C(=N/OS(=O)(=O)c2cccc([N+](=O)[O-])c2)C(Cl)C(Cl)C1=O |
| InChI | InChI=1S/C14H12Cl2N2O6S/c1-7-8(2)14(19)12(16)11(15)13(7)17-24-25(22,23)10-5-3-4-9(6-10)18(20)21/h3-6,11-12H,1-2H3/b17-13- |
| InChIKey | BAYDKAQTIHESQM-LGMDPLHJSA-N |
| XLogP | 2.79 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|