C16H15BrN2O6S — CID 6124422
[(Z)-(3-bromo-2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 3-nitrobenzenesulfonate (PubChem CID 6124422) has the molecular formula C16H15BrN2O6S and a molecular weight of 443.28 g/mol. Its IUPAC name is [(Z)-(3-bromo-2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 3-nitrobenzenesulfonate.
| Compound Name | [(Z)-(3-bromo-2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 6124422 |
| Molecular Formula | C16H15BrN2O6S |
| Molecular Weight | 443.28 g/mol |
| Exact Mass | 441.98 |
| IUPAC Name | [(Z)-(3-bromo-2-methyl-4-oxo-5-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 3-nitrobenzenesulfonate |
| SMILES | CC1=C(Br)C(=O)C(C(C)C)=C/C1=N/OS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15BrN2O6S/c1-9(2)13-8-14(10(3)15(17)16(13)20)18-25-26(23,24)12-6-4-5-11(7-12)19(21)22/h4-9H,1-3H3/b18-14- |
| InChIKey | BPYBTDLSRBMUKG-JXAWBTAJSA-N |
| XLogP | 3.49 |
| TPSA | 115.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|