C16H16BrNO4S — CID 6527508
[(Z)-(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate (PubChem CID 6527508) has the molecular formula C16H16BrNO4S and a molecular weight of 398.28 g/mol. Its IUPAC name is [(Z)-(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate.
| Compound Name | [(Z)-(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate |
|---|---|
| PubChem CID | 6527508 |
| Molecular Formula | C16H16BrNO4S |
| Molecular Weight | 398.28 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | [(Z)-(5-methyl-4-oxo-2-propan-2-ylcyclohexa-2,5-dien-1-ylidene)amino] 4-bromobenzenesulfonate |
| SMILES | CC1=C/C(=N/OS(=O)(=O)c2ccc(Br)cc2)C(C(C)C)=CC1=O |
| InChI | InChI=1S/C16H16BrNO4S/c1-10(2)14-9-16(19)11(3)8-15(14)18-22-23(20,21)13-6-4-12(17)5-7-13/h4-10H,1-3H3/b18-15- |
| InChIKey | JVGLUCJYPAAECJ-SDXDJHTJSA-N |
| XLogP | 3.62 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.28 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|