C12H13BrO4S — CID 42597134
[(Z,2S)-4-(4-bromophenyl)sulfonylbut-3-en-2-yl] acetate (PubChem CID 42597134) has the molecular formula C12H13BrO4S and a molecular weight of 333.20 g/mol. Its IUPAC name is [(Z,2S)-4-(4-bromophenyl)sulfonylbut-3-en-2-yl] acetate.
| Compound Name | [(Z,2S)-4-(4-bromophenyl)sulfonylbut-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 42597134 |
| Molecular Formula | C12H13BrO4S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | [(Z,2S)-4-(4-bromophenyl)sulfonylbut-3-en-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)/C=C\S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C12H13BrO4S/c1-9(17-10(2)14)7-8-18(15,16)12-5-3-11(13)4-6-12/h3-9H,1-2H3/b8-7-/t9-/m0/s1 |
| InChIKey | LFHJPLHFHDNUEC-FUOZMLNRSA-N |
| XLogP | 2.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |