C13H9Cl4NO3S — CID 7344808
N-[(5R,6R)-2,3,5,6-tetrachloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]benzenesulfonamide (PubChem CID 7344808) has the molecular formula C13H9Cl4NO3S and a molecular weight of 401.10 g/mol. Its IUPAC name is N-[(5R,6R)-2,3,5,6-tetrachloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]benzenesulfonamide.
| Compound Name | N-[(5R,6R)-2,3,5,6-tetrachloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 7344808 |
| Molecular Formula | C13H9Cl4NO3S |
| Molecular Weight | 401.10 g/mol |
| Exact Mass | 398.91 |
| IUPAC Name | N-[(5R,6R)-2,3,5,6-tetrachloro-5-methyl-4-oxocyclohex-2-en-1-ylidene]benzenesulfonamide |
| SMILES | C[C@@]1(Cl)C(=O)C(Cl)=C(Cl)C(=NS(=O)(=O)c2ccccc2)[C@H]1Cl |
| InChI | InChI=1S/C13H9Cl4NO3S/c1-13(17)11(16)10(8(14)9(15)12(13)19)18-22(20,21)7-5-3-2-4-6-7/h2-6,11H,1H3/t11-,13+/m1/s1 |
| InChIKey | HCSIHWBZGLSAHA-YPMHNXCESA-N |
| XLogP | 3.69 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.10 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|