C16H20Cl2N2O3S — CID 33162332
N-[1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 33162332) has the molecular formula C16H20Cl2N2O3S and a molecular weight of 391.32 g/mol. Its IUPAC name is N-[1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | N-[1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 33162332 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[1-[(1R)-2,2-dichloro-1-methylcyclopropanecarbonyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | C[C@]1(C(=O)N2CCC(NS(=O)(=O)c3ccccc3)CC2)CC1(Cl)Cl |
| InChI | InChI=1S/C16H20Cl2N2O3S/c1-15(11-16(15,17)18)14(21)20-9-7-12(8-10-20)19-24(22,23)13-5-3-2-4-6-13/h2-6,12,19H,7-11H2,1H3/t15-/m1/s1 |
| InChIKey | UDZCPTYZNVFOID-OAHLLOKOSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|