C16H22N2O5S2 — CID 130287369
[(2Z)-2-(benzenesulfonylhydrazinylidene)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 130287369) has the molecular formula C16H22N2O5S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is [(2Z)-2-(benzenesulfonylhydrazinylidene)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [(2Z)-2-(benzenesulfonylhydrazinylidene)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 130287369 |
| Molecular Formula | C16H22N2O5S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | [(2Z)-2-(benzenesulfonylhydrazinylidene)-1,7-dimethyl-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC12CCC(C/C1=N/NS(=O)(=O)c1ccccc1)C2(C)CS(=O)(=O)O |
| InChI | InChI=1S/C16H22N2O5S2/c1-15-9-8-12(16(15,2)11-24(19,20)21)10-14(15)17-18-25(22,23)13-6-4-3-5-7-13/h3-7,12,18H,8-11H2,1-2H3,(H,19,20,21)/b17-14- |
| InChIKey | RSLRPBWQFBAQAR-VKAVYKQESA-N |
| XLogP | 2.04 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|