C10H16O4S — CID 11180889
[(1R,4R)-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 11180889) has the molecular formula C10H16O4S and a molecular weight of 232.30 g/mol. Its IUPAC name is [(1R,4R)-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [(1R,4R)-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 11180889 |
| Molecular Formula | C10H16O4S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | [(1R,4R)-1,7-dimethyl-2-oxo-7-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(CS(=O)(=O)O)[C@@H]2CC[C@@]1(C)C(=O)C2 |
| InChI | InChI=1S/C10H16O4S/c1-9-4-3-7(5-8(9)11)10(9,2)6-15(12,13)14/h7H,3-6H2,1-2H3,(H,12,13,14)/t7-,9+,10?/m1/s1 |
| InChIKey | AVXBCNFAWJPVFX-IKZKJGMZSA-N |
| XLogP | 1.27 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|