C12H20O2S — CID 7140234
(1S,4S,7R)-7-(2-hydroxyethylsulfanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 7140234) has the molecular formula C12H20O2S and a molecular weight of 228.36 g/mol. Its IUPAC name is (1S,4S,7R)-7-(2-hydroxyethylsulfanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4S,7R)-7-(2-hydroxyethylsulfanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 7140234 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (1S,4S,7R)-7-(2-hydroxyethylsulfanylmethyl)-1,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C[C@@]12CC[C@@H](CC1=O)[C@@]2(C)CSCCO |
| InChI | InChI=1S/C12H20O2S/c1-11-4-3-9(7-10(11)14)12(11,2)8-15-6-5-13/h9,13H,3-8H2,1-2H3/t9-,11+,12+/m0/s1 |
| InChIKey | CLVRHDSFNQCSKV-MVWJERBFSA-N |
| XLogP | 2.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|