C12H13N3O2 — CID 11195606
methyl (2R)-2-azido-3,4-dihydro-1H-naphthalene-2-carboxylate (PubChem CID 11195606) has the molecular formula C12H13N3O2 and a molecular weight of 231.25 g/mol. Its IUPAC name is methyl (2R)-2-azido-3,4-dihydro-1H-naphthalene-2-carboxylate.
| Compound Name | methyl (2R)-2-azido-3,4-dihydro-1H-naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 11195606 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | methyl (2R)-2-azido-3,4-dihydro-1H-naphthalene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(N=[N+]=[N-])CCc2ccccc2C1 |
| InChI | InChI=1S/C12H13N3O2/c1-17-11(16)12(14-15-13)7-6-9-4-2-3-5-10(9)8-12/h2-5H,6-8H2,1H3/t12-/m1/s1 |
| InChIKey | YYSSQPFPASZVSP-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|