C28H29ClO8 — CID 101479721
tetramethyl (8E)-8-(4-chlorophenyl)-5,7,10,12-tetrahydrobenzo[10]annulene-6,6,11,11-tetracarboxylate (PubChem CID 101479721) has the molecular formula C28H29ClO8 and a molecular weight of 528.99 g/mol. Its IUPAC name is tetramethyl (8E)-8-(4-chlorophenyl)-5,7,10,12-tetrahydrobenzo[10]annulene-6,6,11,11-tetracarboxylate.
| Compound Name | tetramethyl (8E)-8-(4-chlorophenyl)-5,7,10,12-tetrahydrobenzo[10]annulene-6,6,11,11-tetracarboxylate |
|---|---|
| PubChem CID | 101479721 |
| Molecular Formula | C28H29ClO8 |
| Molecular Weight | 528.99 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | tetramethyl (8E)-8-(4-chlorophenyl)-5,7,10,12-tetrahydrobenzo[10]annulene-6,6,11,11-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C/C=C(/c2ccc(Cl)cc2)CC(C(=O)OC)(C(=O)OC)Cc2ccccc2C1 |
| InChI | InChI=1S/C28H29ClO8/c1-34-23(30)27(24(31)35-2)14-13-21(18-9-11-22(29)12-10-18)17-28(25(32)36-3,26(33)37-4)16-20-8-6-5-7-19(20)15-27/h5-13H,14-17H2,1-4H3/b21-13+ |
| InChIKey | UTWLIYGHHOEJQJ-FYJGNVAPSA-N |
| XLogP | 3.97 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.99 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|