C25H18Cl2O4 — CID 101269157
dimethyl 3,4-bis[2-(4-chlorophenyl)ethynyl]cyclopent-3-ene-1,1-dicarboxylate (PubChem CID 101269157) has the molecular formula C25H18Cl2O4 and a molecular weight of 453.32 g/mol. Its IUPAC name is dimethyl 3,4-bis[2-(4-chlorophenyl)ethynyl]cyclopent-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3,4-bis[2-(4-chlorophenyl)ethynyl]cyclopent-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101269157 |
| Molecular Formula | C25H18Cl2O4 |
| Molecular Weight | 453.32 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | dimethyl 3,4-bis[2-(4-chlorophenyl)ethynyl]cyclopent-3-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C#Cc2ccc(Cl)cc2)=C(C#Cc2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C25H18Cl2O4/c1-30-23(28)25(24(29)31-2)15-19(9-3-17-5-11-21(26)12-6-17)20(16-25)10-4-18-7-13-22(27)14-8-18/h5-8,11-14H,15-16H2,1-2H3 |
| InChIKey | CVAJYEOYAUJYPW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.32 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|