C13H9ClF2O — CID 14695246
3-(4-chlorophenyl)-1-(2,2-difluoro-1-methylcyclopropyl)prop-2-yn-1-one (PubChem CID 14695246) has the molecular formula C13H9ClF2O and a molecular weight of 254.66 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2,2-difluoro-1-methylcyclopropyl)prop-2-yn-1-one.
| Compound Name | 3-(4-chlorophenyl)-1-(2,2-difluoro-1-methylcyclopropyl)prop-2-yn-1-one |
|---|---|
| PubChem CID | 14695246 |
| Molecular Formula | C13H9ClF2O |
| Molecular Weight | 254.66 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2,2-difluoro-1-methylcyclopropyl)prop-2-yn-1-one |
| SMILES | CC1(C(=O)C#Cc2ccc(Cl)cc2)CC1(F)F |
| InChI | InChI=1S/C13H9ClF2O/c1-12(8-13(12,15)16)11(17)7-4-9-2-5-10(14)6-3-9/h2-3,5-6H,8H2,1H3 |
| InChIKey | KPYCFOGNPOYEEZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.66 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|