About methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate
methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 116842803) has the molecular formula C13H15ClO2
and a molecular weight of 238.71 g/mol. Its IUPAC name is methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| PubChem CID | 116842803 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1(c2ccc(Cl)cc2)CC1(C)C |
| InChI | InChI=1S/C13H15ClO2/c1-12(2)8-13(12,11(15)16-3)9-4-6-10(14)7-5-9/h4-7H,8H2,1-3H3 |
| InChIKey | MZANXVHQHDLJRZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The IUPAC name of methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate (CID 116842803) is methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate.
What is the SMILES notation for methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The canonical SMILES for methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate is COC(=O)C1(c2ccc(Cl)cc2)CC1(C)C.
What is the InChIKey of methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate?
The InChIKey is MZANXVHQHDLJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15ClO2/c1-12(2)8-13(12,11(15)16-3)9-4-6-10(14)7-5-9/h4-7H,8H2,1-3H3.
What are the key properties of methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate?
methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate has a molecular weight of 238.71 g/mol, XLogP of 3.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(4-chlorophenyl)-2,2-dimethylcyclopropane-1-carboxylate is sourced from PubChem (CID 116842803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).