methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate

C16H22O2 — CID 116842819

IUPACmethyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate
SMILESCCCc1ccc(C2(C(=O)OC)CC2(C)C)cc1
InChIInChI=1S/C16H22O2/c1-5-6-12-7-9-13(10-8-12)16(14(17)18-4)11-15(16,2)3/h7-10H,5-6,11H2,1-4H3
InChIKeyJAQJBCUQHDPMNF-UHFFFAOYSA-N
MW246.35 g/mol
LogP3.48
Rot. Bonds4

About methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate

methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate (PubChem CID 116842819) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate.

Molecular Properties

Compound Namemethyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate
PubChem CID116842819
Molecular FormulaC16H22O2
Molecular Weight246.35 g/mol
Exact Mass246.16
IUPAC Namemethyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate
SMILESCCCc1ccc(C2(C(=O)OC)CC2(C)C)cc1
InChIInChI=1S/C16H22O2/c1-5-6-12-7-9-13(10-8-12)16(14(17)18-4)11-15(16,2)3/h7-10H,5-6,11H2,1-4H3
InChIKeyJAQJBCUQHDPMNF-UHFFFAOYSA-N
XLogP3.48
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.35
LogP ≤ 53.48
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate?
The IUPAC name of methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate (CID 116842819) is methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate.
What is the SMILES notation for methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate?
The canonical SMILES for methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate is CCCc1ccc(C2(C(=O)OC)CC2(C)C)cc1.
What is the InChIKey of methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate?
The InChIKey is JAQJBCUQHDPMNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O2/c1-5-6-12-7-9-13(10-8-12)16(14(17)18-4)11-15(16,2)3/h7-10H,5-6,11H2,1-4H3.
What are the key properties of methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate?
methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate has a molecular weight of 246.35 g/mol, XLogP of 3.48, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-1-(4-propylphenyl)cyclopropane-1-carboxylate is sourced from PubChem (CID 116842819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).