C13H13ClO3 — CID 132502453
methyl 3-(4-chlorophenyl)-2,4-dihydropyran-3-carboxylate (PubChem CID 132502453) has the molecular formula C13H13ClO3 and a molecular weight of 252.70 g/mol. Its IUPAC name is methyl 3-(4-chlorophenyl)-2,4-dihydropyran-3-carboxylate.
| Compound Name | methyl 3-(4-chlorophenyl)-2,4-dihydropyran-3-carboxylate |
|---|---|
| PubChem CID | 132502453 |
| Molecular Formula | C13H13ClO3 |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | methyl 3-(4-chlorophenyl)-2,4-dihydropyran-3-carboxylate |
| SMILES | COC(=O)C1(c2ccc(Cl)cc2)CC=COC1 |
| InChI | InChI=1S/C13H13ClO3/c1-16-12(15)13(7-2-8-17-9-13)10-3-5-11(14)6-4-10/h2-6,8H,7,9H2,1H3 |
| InChIKey | LGHOJXXZPALYJB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |